C22H29N2O2+ — CID 7283594
methyl (1S,9R,16S,18R,21S)-12-methyl-2-aza-12-azoniahexacyclo[14.2.2.19,12.01,9.03,8.016,21]henicosa-3,5,7-triene-18-carboxylate (PubChem CID 7283594) has the molecular formula C22H29N2O2+ and a molecular weight of 353.49 g/mol. Its IUPAC name is methyl (1S,9R,16S,18R,21S)-12-methyl-2-aza-12-azoniahexacyclo[14.2.2.19,12.01,9.03,8.016,21]henicosa-3,5,7-triene-18-carboxylate.
| Compound Name | methyl (1S,9R,16S,18R,21S)-12-methyl-2-aza-12-azoniahexacyclo[14.2.2.19,12.01,9.03,8.016,21]henicosa-3,5,7-triene-18-carboxylate |
|---|---|
| PubChem CID | 7283594 |
| Molecular Formula | C22H29N2O2+ |
| Molecular Weight | 353.49 g/mol |
| Exact Mass | 353.22 |
| IUPAC Name | methyl (1S,9R,16S,18R,21S)-12-methyl-2-aza-12-azoniahexacyclo[14.2.2.19,12.01,9.03,8.016,21]henicosa-3,5,7-triene-18-carboxylate |
| SMILES | COC(=O)[C@@H]1C[C@]23CCC[N+]4(C)CC[C@@]5(c6ccccc6N[C@@]15CC2)[C@H]34 |
| InChI | InChI=1S/C22H29N2O2/c1-24-12-5-8-20-9-10-22(16(14-20)18(25)26-2)21(11-13-24,19(20)24)15-6-3-4-7-17(15)23-22/h3-4,6-7,16,19,23H,5,8-14H2,1-2H3/q+1/t16-,19-,20-,21+,22-,24?/m0/s1 |
| InChIKey | MQASNJGBUISRNK-IYYUWXGDSA-N |
| XLogP | 3.07 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.49 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|