C24H23F6N5O5S2 — CID 118709638
2-[6-[4-[(6-amino-3-pyridinyl)sulfonyl]piperazin-1-yl]-5-(4-methylsulfonylphenyl)-3-pyridinyl]-1,1,1,3,3,3-hexafluoropropan-2-ol (PubChem CID 118709638) has the molecular formula C24H23F6N5O5S2 and a molecular weight of 639.60 g/mol. Its IUPAC name is 2-[6-[4-[(6-amino-3-pyridinyl)sulfonyl]piperazin-1-yl]-5-(4-methylsulfonylphenyl)-3-pyridinyl]-1,1,1,3,3,3-hexafluoropropan-2-ol.
| Compound Name | 2-[6-[4-[(6-amino-3-pyridinyl)sulfonyl]piperazin-1-yl]-5-(4-methylsulfonylphenyl)-3-pyridinyl]-1,1,1,3,3,3-hexafluoropropan-2-ol |
|---|---|
| PubChem CID | 118709638 |
| Molecular Formula | C24H23F6N5O5S2 |
| Molecular Weight | 639.60 g/mol |
| Exact Mass | 639.10 |
| IUPAC Name | 2-[6-[4-[(6-amino-3-pyridinyl)sulfonyl]piperazin-1-yl]-5-(4-methylsulfonylphenyl)-3-pyridinyl]-1,1,1,3,3,3-hexafluoropropan-2-ol |
| SMILES | CS(=O)(=O)c1ccc(-c2cc(C(O)(C(F)(F)F)C(F)(F)F)cnc2N2CCN(S(=O)(=O)c3ccc(N)nc3)CC2)cc1 |
| InChI | InChI=1S/C24H23F6N5O5S2/c1-41(37,38)17-4-2-15(3-5-17)19-12-16(22(36,23(25,26)27)24(28,29)30)13-33-21(19)34-8-10-35(11-9-34)42(39,40)18-6-7-20(31)32-14-18/h2-7,12-14,36H,8-11H2,1H3,(H2,31,32) |
| InChIKey | DQCSAQAYLJJUSA-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 146.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 639.60 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |