C12H10N2O4S — CID 118710200
4-[(6-methyl-2,2,4-trioxooxathiazin-3-yl)methyl]benzonitrile (PubChem CID 118710200) has the molecular formula C12H10N2O4S and a molecular weight of 278.29 g/mol. Its IUPAC name is 4-[(6-methyl-2,2,4-trioxooxathiazin-3-yl)methyl]benzonitrile.
| Compound Name | 4-[(6-methyl-2,2,4-trioxooxathiazin-3-yl)methyl]benzonitrile |
|---|---|
| PubChem CID | 118710200 |
| Molecular Formula | C12H10N2O4S |
| Molecular Weight | 278.29 g/mol |
| Exact Mass | 278.04 |
| IUPAC Name | 4-[(6-methyl-2,2,4-trioxooxathiazin-3-yl)methyl]benzonitrile |
| SMILES | CC1=CC(=O)N(Cc2ccc(C#N)cc2)S(=O)(=O)O1 |
| InChI | InChI=1S/C12H10N2O4S/c1-9-6-12(15)14(19(16,17)18-9)8-11-4-2-10(7-13)3-5-11/h2-6H,8H2,1H3 |
| InChIKey | JVZURBDGHMCQTR-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 87.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.29 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |