C26H30F3N3O — CID 118711207
(1R,9aR)-1-[[2-[(4-methoxyphenyl)methyl]-5-(trifluoromethyl)benzimidazol-1-yl]methyl]-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizine (PubChem CID 118711207) has the molecular formula C26H30F3N3O and a molecular weight of 457.54 g/mol. Its IUPAC name is (1R,9aR)-1-[[2-[(4-methoxyphenyl)methyl]-5-(trifluoromethyl)benzimidazol-1-yl]methyl]-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizine.
| Compound Name | (1R,9aR)-1-[[2-[(4-methoxyphenyl)methyl]-5-(trifluoromethyl)benzimidazol-1-yl]methyl]-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizine |
|---|---|
| PubChem CID | 118711207 |
| Molecular Formula | C26H30F3N3O |
| Molecular Weight | 457.54 g/mol |
| Exact Mass | 457.23 |
| IUPAC Name | (1R,9aR)-1-[[2-[(4-methoxyphenyl)methyl]-5-(trifluoromethyl)benzimidazol-1-yl]methyl]-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizine |
| SMILES | COc1ccc(Cc2nc3cc(C(F)(F)F)ccc3n2C[C@H]2CCCN3CCCC[C@H]23)cc1 |
| InChI | InChI=1S/C26H30F3N3O/c1-33-21-10-7-18(8-11-21)15-25-30-22-16-20(26(27,28)29)9-12-24(22)32(25)17-19-5-4-14-31-13-3-2-6-23(19)31/h7-12,16,19,23H,2-6,13-15,17H2,1H3/t19-,23-/m1/s1 |
| InChIKey | TZCMOUOFLGIXFI-AUSIDOKSSA-N |
| XLogP | 5.92 |
| TPSA | 30.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.54 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |