C20H27Cl3N2O3 — CID 3375216
N-[1-(2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-1-ylmethoxy)-2,2,2-trichloroethyl]-4-methoxybenzamide (PubChem CID 3375216) has the molecular formula C20H27Cl3N2O3 and a molecular weight of 449.81 g/mol. Its IUPAC name is N-[1-(2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-1-ylmethoxy)-2,2,2-trichloroethyl]-4-methoxybenzamide.
| Compound Name | N-[1-(2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-1-ylmethoxy)-2,2,2-trichloroethyl]-4-methoxybenzamide |
|---|---|
| PubChem CID | 3375216 |
| Molecular Formula | C20H27Cl3N2O3 |
| Molecular Weight | 449.81 g/mol |
| Exact Mass | 448.11 |
| IUPAC Name | N-[1-(2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-1-ylmethoxy)-2,2,2-trichloroethyl]-4-methoxybenzamide |
| SMILES | COc1ccc(C(=O)NC(OCC2CCCN3CCCCC23)C(Cl)(Cl)Cl)cc1 |
| InChI | InChI=1S/C20H27Cl3N2O3/c1-27-16-9-7-14(8-10-16)18(26)24-19(20(21,22)23)28-13-15-5-4-12-25-11-3-2-6-17(15)25/h7-10,15,17,19H,2-6,11-13H2,1H3,(H,24,26) |
| InChIKey | ATPAPKBRPPCFQM-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.81 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|