C19H24BrCl3N2O2 — CID 26917539
N-[(1R)-1-[[(1S,9aS)-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-1-yl]methoxy]-2,2,2-trichloroethyl]-2-bromobenzamide (PubChem CID 26917539) has the molecular formula C19H24BrCl3N2O2 and a molecular weight of 498.68 g/mol. Its IUPAC name is N-[(1R)-1-[[(1S,9aS)-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-1-yl]methoxy]-2,2,2-trichloroethyl]-2-bromobenzamide.
| Compound Name | N-[(1R)-1-[[(1S,9aS)-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-1-yl]methoxy]-2,2,2-trichloroethyl]-2-bromobenzamide |
|---|---|
| PubChem CID | 26917539 |
| Molecular Formula | C19H24BrCl3N2O2 |
| Molecular Weight | 498.68 g/mol |
| Exact Mass | 496.01 |
| IUPAC Name | N-[(1R)-1-[[(1S,9aS)-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-1-yl]methoxy]-2,2,2-trichloroethyl]-2-bromobenzamide |
| SMILES | O=C(N[C@H](OC[C@H]1CCCN2CCCC[C@@H]12)C(Cl)(Cl)Cl)c1ccccc1Br |
| InChI | InChI=1S/C19H24BrCl3N2O2/c20-15-8-2-1-7-14(15)17(26)24-18(19(21,22)23)27-12-13-6-5-11-25-10-4-3-9-16(13)25/h1-2,7-8,13,16,18H,3-6,9-12H2,(H,24,26)/t13-,16+,18-/m1/s1 |
| InChIKey | NHOWDDFUHDJVCH-RPVQJOFSSA-N |
| XLogP | 5.16 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.68 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|