C19H34N2O — CID 118711803
2-decyl-6-(dimethylamino)-4,5-dimethylpyridin-3-ol (PubChem CID 118711803) has the molecular formula C19H34N2O and a molecular weight of 306.49 g/mol. Its IUPAC name is 2-decyl-6-(dimethylamino)-4,5-dimethylpyridin-3-ol.
| Compound Name | 2-decyl-6-(dimethylamino)-4,5-dimethylpyridin-3-ol |
|---|---|
| PubChem CID | 118711803 |
| Molecular Formula | C19H34N2O |
| Molecular Weight | 306.49 g/mol |
| Exact Mass | 306.27 |
| IUPAC Name | 2-decyl-6-(dimethylamino)-4,5-dimethylpyridin-3-ol |
| SMILES | CCCCCCCCCCc1nc(N(C)C)c(C)c(C)c1O |
| InChI | InChI=1S/C19H34N2O/c1-6-7-8-9-10-11-12-13-14-17-18(22)15(2)16(3)19(20-17)21(4)5/h22H,6-14H2,1-5H3 |
| InChIKey | NRVYEVNFLXWFKR-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 36.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.49 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|