C12H17N2O6P — CID 118716377
[1-benzamido-4-[hydroxy(methyl)amino]-4-oxobutyl]phosphonic acid (PubChem CID 118716377) has the molecular formula C12H17N2O6P and a molecular weight of 316.25 g/mol. Its IUPAC name is [1-benzamido-4-[hydroxy(methyl)amino]-4-oxobutyl]phosphonic acid.
| Compound Name | [1-benzamido-4-[hydroxy(methyl)amino]-4-oxobutyl]phosphonic acid |
|---|---|
| PubChem CID | 118716377 |
| Molecular Formula | C12H17N2O6P |
| Molecular Weight | 316.25 g/mol |
| Exact Mass | 316.08 |
| IUPAC Name | [1-benzamido-4-[hydroxy(methyl)amino]-4-oxobutyl]phosphonic acid |
| SMILES | CN(O)C(=O)CCC(NC(=O)c1ccccc1)P(=O)(O)O |
| InChI | InChI=1S/C12H17N2O6P/c1-14(17)11(15)8-7-10(21(18,19)20)13-12(16)9-5-3-2-4-6-9/h2-6,10,17H,7-8H2,1H3,(H,13,16)(H2,18,19,20) |
| InChIKey | DIHZMVOBBRRTTG-UHFFFAOYSA-N |
| XLogP | 0.55 |
| TPSA | 127.17 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.25 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|