C25H44O7 — CID 118718424
[(1S,3R)-4-hydroxy-1-[(2S,3S,6R)-6-hydroxy-2-[2-[(2R,4R)-4-hydroxy-6-oxooxan-2-yl]ethyl]-3-methylcyclohexyl]-3-methylbutyl] 2,2-dimethylbutanoate (PubChem CID 118718424) has the molecular formula C25H44O7 and a molecular weight of 456.62 g/mol. Its IUPAC name is [(1S,3R)-4-hydroxy-1-[(2S,3S,6R)-6-hydroxy-2-[2-[(2R,4R)-4-hydroxy-6-oxooxan-2-yl]ethyl]-3-methylcyclohexyl]-3-methylbutyl] 2,2-dimethylbutanoate.
| Compound Name | [(1S,3R)-4-hydroxy-1-[(2S,3S,6R)-6-hydroxy-2-[2-[(2R,4R)-4-hydroxy-6-oxooxan-2-yl]ethyl]-3-methylcyclohexyl]-3-methylbutyl] 2,2-dimethylbutanoate |
|---|---|
| PubChem CID | 118718424 |
| Molecular Formula | C25H44O7 |
| Molecular Weight | 456.62 g/mol |
| Exact Mass | 456.31 |
| IUPAC Name | [(1S,3R)-4-hydroxy-1-[(2S,3S,6R)-6-hydroxy-2-[2-[(2R,4R)-4-hydroxy-6-oxooxan-2-yl]ethyl]-3-methylcyclohexyl]-3-methylbutyl] 2,2-dimethylbutanoate |
| SMILES | CCC(C)(C)C(=O)OC(C[C@@H](C)CO)C1[C@H](O)CC[C@H](C)[C@@H]1CC[C@@H]1C[C@@H](O)CC(=O)O1 |
| InChI | InChI=1S/C25H44O7/c1-6-25(4,5)24(30)32-21(11-15(2)14-26)23-19(16(3)7-10-20(23)28)9-8-18-12-17(27)13-22(29)31-18/h15-21,23,26-28H,6-14H2,1-5H3/t15-,16+,17-,18-,19+,20-,21?,23?/m1/s1 |
| InChIKey | BBJHGQSAVYWHGJ-RZALLVDTSA-N |
| XLogP | 3.22 |
| TPSA | 113.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.62 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |