C9H20INO — CID 118719160
[(1S,3S)-3-hydroxycyclopentyl]methyl-trimethylazanium iodide (PubChem CID 118719160) has the molecular formula C9H20INO and a molecular weight of 285.17 g/mol. Its IUPAC name is [(1S,3S)-3-hydroxycyclopentyl]methyl-trimethylazanium iodide.
| Compound Name | [(1S,3S)-3-hydroxycyclopentyl]methyl-trimethylazanium iodide |
|---|---|
| PubChem CID | 118719160 |
| Molecular Formula | C9H20INO |
| Molecular Weight | 285.17 g/mol |
| Exact Mass | 285.06 |
| IUPAC Name | [(1S,3S)-3-hydroxycyclopentyl]methyl-trimethylazanium iodide |
| SMILES | C[N+](C)(C)C[C@H]1CC[C@H](O)C1.[I-] |
| InChI | InChI=1S/C9H20NO.HI/c1-10(2,3)7-8-4-5-9(11)6-8;/h8-9,11H,4-7H2,1-3H3;1H/q+1;/p-1/t8-,9-;/m0./s1 |
| InChIKey | VUGQDBCLJPWNTR-OZZZDHQUSA-M |
| XLogP | -2.14 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.17 |
| LogP ≤ 5 | -2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|