C23H27N3O5 — CID 118721303
(3R)-1-[4-(3,5-dimethyl-1,2-oxazol-4-yl)phenyl]-2,5-diethyl-3-methyl-4,6-dioxo-3a,6a-dihydro-1H-pyrrolo[3,4-c]pyrrole-3-carboxylic acid (PubChem CID 118721303) has the molecular formula C23H27N3O5 and a molecular weight of 425.49 g/mol. Its IUPAC name is (3R)-1-[4-(3,5-dimethyl-1,2-oxazol-4-yl)phenyl]-2,5-diethyl-3-methyl-4,6-dioxo-3a,6a-dihydro-1H-pyrrolo[3,4-c]pyrrole-3-carboxylic acid.
| Compound Name | (3R)-1-[4-(3,5-dimethyl-1,2-oxazol-4-yl)phenyl]-2,5-diethyl-3-methyl-4,6-dioxo-3a,6a-dihydro-1H-pyrrolo[3,4-c]pyrrole-3-carboxylic acid |
|---|---|
| PubChem CID | 118721303 |
| Molecular Formula | C23H27N3O5 |
| Molecular Weight | 425.49 g/mol |
| Exact Mass | 425.20 |
| IUPAC Name | (3R)-1-[4-(3,5-dimethyl-1,2-oxazol-4-yl)phenyl]-2,5-diethyl-3-methyl-4,6-dioxo-3a,6a-dihydro-1H-pyrrolo[3,4-c]pyrrole-3-carboxylic acid |
| SMILES | CCN1C(=O)C2C(c3ccc(-c4c(C)noc4C)cc3)N(CC)[C@@](C)(C(=O)O)C2C1=O |
| InChI | InChI=1S/C23H27N3O5/c1-6-25-20(27)17-18(21(25)28)23(5,22(29)30)26(7-2)19(17)15-10-8-14(9-11-15)16-12(3)24-31-13(16)4/h8-11,17-19H,6-7H2,1-5H3,(H,29,30)/t17?,18?,19?,23-/m1/s1 |
| InChIKey | LACNPMHTNKNMLJ-DWLUCLHISA-N |
| XLogP | 2.80 |
| TPSA | 103.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.49 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|