C18H16N4O5S — CID 118724136
3-[[3-(3-methoxyanilino)pyrazin-2-yl]sulfamoyl]benzoic acid (PubChem CID 118724136) has the molecular formula C18H16N4O5S and a molecular weight of 400.42 g/mol. Its IUPAC name is 3-[[3-(3-methoxyanilino)pyrazin-2-yl]sulfamoyl]benzoic acid.
| Compound Name | 3-[[3-(3-methoxyanilino)pyrazin-2-yl]sulfamoyl]benzoic acid |
|---|---|
| PubChem CID | 118724136 |
| Molecular Formula | C18H16N4O5S |
| Molecular Weight | 400.42 g/mol |
| Exact Mass | 400.08 |
| IUPAC Name | 3-[[3-(3-methoxyanilino)pyrazin-2-yl]sulfamoyl]benzoic acid |
| SMILES | COc1cccc(Nc2nccnc2NS(=O)(=O)c2cccc(C(=O)O)c2)c1 |
| InChI | InChI=1S/C18H16N4O5S/c1-27-14-6-3-5-13(11-14)21-16-17(20-9-8-19-16)22-28(25,26)15-7-2-4-12(10-15)18(23)24/h2-11H,1H3,(H,19,21)(H,20,22)(H,23,24) |
| InChIKey | PXZBFIKFALTSFZ-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 130.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.42 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |