C29H39N3O3 — CID 118729056
2-[8-[[1-[(4-methoxyphenyl)methyl]piperidin-4-yl]amino]octyl]isoindole-1,3-dione (PubChem CID 118729056) has the molecular formula C29H39N3O3 and a molecular weight of 477.65 g/mol. Its IUPAC name is 2-[8-[[1-[(4-methoxyphenyl)methyl]piperidin-4-yl]amino]octyl]isoindole-1,3-dione.
| Compound Name | 2-[8-[[1-[(4-methoxyphenyl)methyl]piperidin-4-yl]amino]octyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 118729056 |
| Molecular Formula | C29H39N3O3 |
| Molecular Weight | 477.65 g/mol |
| Exact Mass | 477.30 |
| IUPAC Name | 2-[8-[[1-[(4-methoxyphenyl)methyl]piperidin-4-yl]amino]octyl]isoindole-1,3-dione |
| SMILES | COc1ccc(CN2CCC(NCCCCCCCCN3C(=O)c4ccccc4C3=O)CC2)cc1 |
| InChI | InChI=1S/C29H39N3O3/c1-35-25-14-12-23(13-15-25)22-31-20-16-24(17-21-31)30-18-8-4-2-3-5-9-19-32-28(33)26-10-6-7-11-27(26)29(32)34/h6-7,10-15,24,30H,2-5,8-9,16-22H2,1H3 |
| InChIKey | XGSVNQWVLYUGCM-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.65 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|