C20H18F2N6OS — CID 118730081
2-(2,4-difluorophenyl)-1-[[5-(4-methylphenyl)-1H-1,2,4-triazol-3-yl]sulfanyl]-3-(1,2,4-triazol-1-yl)propan-2-ol (PubChem CID 118730081) has the molecular formula C20H18F2N6OS and a molecular weight of 428.47 g/mol. Its IUPAC name is 2-(2,4-difluorophenyl)-1-[[5-(4-methylphenyl)-1H-1,2,4-triazol-3-yl]sulfanyl]-3-(1,2,4-triazol-1-yl)propan-2-ol.
| Compound Name | 2-(2,4-difluorophenyl)-1-[[5-(4-methylphenyl)-1H-1,2,4-triazol-3-yl]sulfanyl]-3-(1,2,4-triazol-1-yl)propan-2-ol |
|---|---|
| PubChem CID | 118730081 |
| Molecular Formula | C20H18F2N6OS |
| Molecular Weight | 428.47 g/mol |
| Exact Mass | 428.12 |
| IUPAC Name | 2-(2,4-difluorophenyl)-1-[[5-(4-methylphenyl)-1H-1,2,4-triazol-3-yl]sulfanyl]-3-(1,2,4-triazol-1-yl)propan-2-ol |
| SMILES | Cc1ccc(-c2nc(SCC(O)(Cn3cncn3)c3ccc(F)cc3F)n[nH]2)cc1 |
| InChI | InChI=1S/C20H18F2N6OS/c1-13-2-4-14(5-3-13)18-25-19(27-26-18)30-10-20(29,9-28-12-23-11-24-28)16-7-6-15(21)8-17(16)22/h2-8,11-12,29H,9-10H2,1H3,(H,25,26,27) |
| InChIKey | RUHKOZDSZUGPIZ-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 92.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.47 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |