C20H14N4OS — CID 118730249
4-(1,3-benzothiazol-2-yl)-N-[(Z)-pyridin-2-ylmethylideneamino]benzamide (PubChem CID 118730249) has the molecular formula C20H14N4OS and a molecular weight of 358.43 g/mol. Its IUPAC name is 4-(1,3-benzothiazol-2-yl)-N-[(Z)-pyridin-2-ylmethylideneamino]benzamide.
| Compound Name | 4-(1,3-benzothiazol-2-yl)-N-[(Z)-pyridin-2-ylmethylideneamino]benzamide |
|---|---|
| PubChem CID | 118730249 |
| Molecular Formula | C20H14N4OS |
| Molecular Weight | 358.43 g/mol |
| Exact Mass | 358.09 |
| IUPAC Name | 4-(1,3-benzothiazol-2-yl)-N-[(Z)-pyridin-2-ylmethylideneamino]benzamide |
| SMILES | O=C(N/N=C\c1ccccn1)c1ccc(-c2nc3ccccc3s2)cc1 |
| InChI | InChI=1S/C20H14N4OS/c25-19(24-22-13-16-5-3-4-12-21-16)14-8-10-15(11-9-14)20-23-17-6-1-2-7-18(17)26-20/h1-13H,(H,24,25)/b22-13- |
| InChIKey | PCHBTLORUARFLX-XKZIYDEJSA-N |
| XLogP | 4.12 |
| TPSA | 67.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.43 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|