C22H16IN3O3S — CID 118730275
4-(1,3-benzothiazol-2-yl)-N-[(E)-(3-hydroxy-2-iodo-4-methoxyphenyl)methylideneamino]benzamide (PubChem CID 118730275) has the molecular formula C22H16IN3O3S and a molecular weight of 529.36 g/mol. Its IUPAC name is 4-(1,3-benzothiazol-2-yl)-N-[(E)-(3-hydroxy-2-iodo-4-methoxyphenyl)methylideneamino]benzamide.
| Compound Name | 4-(1,3-benzothiazol-2-yl)-N-[(E)-(3-hydroxy-2-iodo-4-methoxyphenyl)methylideneamino]benzamide |
|---|---|
| PubChem CID | 118730275 |
| Molecular Formula | C22H16IN3O3S |
| Molecular Weight | 529.36 g/mol |
| Exact Mass | 529.00 |
| IUPAC Name | 4-(1,3-benzothiazol-2-yl)-N-[(E)-(3-hydroxy-2-iodo-4-methoxyphenyl)methylideneamino]benzamide |
| SMILES | COc1ccc(/C=N/NC(=O)c2ccc(-c3nc4ccccc4s3)cc2)c(I)c1O |
| InChI | InChI=1S/C22H16IN3O3S/c1-29-17-11-10-15(19(23)20(17)27)12-24-26-21(28)13-6-8-14(9-7-13)22-25-16-4-2-3-5-18(16)30-22/h2-12,27H,1H3,(H,26,28)/b24-12+ |
| InChIKey | JALFJPNMPLVRIM-WYMPLXKRSA-N |
| XLogP | 5.05 |
| TPSA | 83.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.36 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|