C22H32F2NO12P — CID 118732312
[butoxycarbonyloxymethoxy-[(3,4-difluorophenyl)-[2-[hydroxy(methyl)amino]-2-oxoethoxy]methyl]phosphoryl]oxymethyl butyl carbonate (PubChem CID 118732312) has the molecular formula C22H32F2NO12P and a molecular weight of 571.46 g/mol. Its IUPAC name is [butoxycarbonyloxymethoxy-[(3,4-difluorophenyl)-[2-[hydroxy(methyl)amino]-2-oxoethoxy]methyl]phosphoryl]oxymethyl butyl carbonate.
| Compound Name | [butoxycarbonyloxymethoxy-[(3,4-difluorophenyl)-[2-[hydroxy(methyl)amino]-2-oxoethoxy]methyl]phosphoryl]oxymethyl butyl carbonate |
|---|---|
| PubChem CID | 118732312 |
| Molecular Formula | C22H32F2NO12P |
| Molecular Weight | 571.46 g/mol |
| Exact Mass | 571.16 |
| IUPAC Name | [butoxycarbonyloxymethoxy-[(3,4-difluorophenyl)-[2-[hydroxy(methyl)amino]-2-oxoethoxy]methyl]phosphoryl]oxymethyl butyl carbonate |
| SMILES | CCCCOC(=O)OCOP(=O)(OCOC(=O)OCCCC)C(OCC(=O)N(C)O)c1ccc(F)c(F)c1 |
| InChI | InChI=1S/C22H32F2NO12P/c1-4-6-10-31-21(27)34-14-36-38(30,37-15-35-22(28)32-11-7-5-2)20(33-13-19(26)25(3)29)16-8-9-17(23)18(24)12-16/h8-9,12,20,29H,4-7,10-11,13-15H2,1-3H3 |
| InChIKey | WRBSYOFADXHRTK-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 156.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.46 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|