C13H18F2NO5PS — CID 72711297
2-[diethoxyphosphoryl-(3,4-difluorophenyl)methyl]sulfanyl-N-hydroxyacetamide (PubChem CID 72711297) has the molecular formula C13H18F2NO5PS and a molecular weight of 369.33 g/mol. Its IUPAC name is 2-[diethoxyphosphoryl-(3,4-difluorophenyl)methyl]sulfanyl-N-hydroxyacetamide.
| Compound Name | 2-[diethoxyphosphoryl-(3,4-difluorophenyl)methyl]sulfanyl-N-hydroxyacetamide |
|---|---|
| PubChem CID | 72711297 |
| Molecular Formula | C13H18F2NO5PS |
| Molecular Weight | 369.33 g/mol |
| Exact Mass | 369.06 |
| IUPAC Name | 2-[diethoxyphosphoryl-(3,4-difluorophenyl)methyl]sulfanyl-N-hydroxyacetamide |
| SMILES | CCOP(=O)(OCC)C(SCC(=O)NO)c1ccc(F)c(F)c1 |
| InChI | InChI=1S/C13H18F2NO5PS/c1-3-20-22(19,21-4-2)13(23-8-12(17)16-18)9-5-6-10(14)11(15)7-9/h5-7,13,18H,3-4,8H2,1-2H3,(H,16,17) |
| InChIKey | IRXLKJVRJRPBGH-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.33 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|