C14H9F2N5O3S — CID 118732531
N-[4-(3,4-difluorophenyl)-1,3-thiazol-2-yl]-2-(2-nitroimidazol-1-yl)acetamide (PubChem CID 118732531) has the molecular formula C14H9F2N5O3S and a molecular weight of 365.32 g/mol. Its IUPAC name is N-[4-(3,4-difluorophenyl)-1,3-thiazol-2-yl]-2-(2-nitroimidazol-1-yl)acetamide.
| Compound Name | N-[4-(3,4-difluorophenyl)-1,3-thiazol-2-yl]-2-(2-nitroimidazol-1-yl)acetamide |
|---|---|
| PubChem CID | 118732531 |
| Molecular Formula | C14H9F2N5O3S |
| Molecular Weight | 365.32 g/mol |
| Exact Mass | 365.04 |
| IUPAC Name | N-[4-(3,4-difluorophenyl)-1,3-thiazol-2-yl]-2-(2-nitroimidazol-1-yl)acetamide |
| SMILES | O=C(Cn1ccnc1[N+](=O)[O-])Nc1nc(-c2ccc(F)c(F)c2)cs1 |
| InChI | InChI=1S/C14H9F2N5O3S/c15-9-2-1-8(5-10(9)16)11-7-25-13(18-11)19-12(22)6-20-4-3-17-14(20)21(23)24/h1-5,7H,6H2,(H,18,19,22) |
| InChIKey | GOABCPJBDQUQIS-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 102.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.32 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|