C26H24ClO2P — CID 118733306
chloro-(2,5-dimethoxyphenyl)-triphenyl-λ5-phosphane (PubChem CID 118733306) has the molecular formula C26H24ClO2P and a molecular weight of 434.90 g/mol. Its IUPAC name is chloro-(2,5-dimethoxyphenyl)-triphenyl-λ5-phosphane.
| Compound Name | chloro-(2,5-dimethoxyphenyl)-triphenyl-λ5-phosphane |
|---|---|
| PubChem CID | 118733306 |
| Molecular Formula | C26H24ClO2P |
| Molecular Weight | 434.90 g/mol |
| Exact Mass | 434.12 |
| IUPAC Name | chloro-(2,5-dimethoxyphenyl)-triphenyl-λ5-phosphane |
| SMILES | COc1ccc(OC)c(P(Cl)(c2ccccc2)(c2ccccc2)c2ccccc2)c1 |
| InChI | InChI=1S/C26H24ClO2P/c1-28-21-18-19-25(29-2)26(20-21)30(27,22-12-6-3-7-13-22,23-14-8-4-9-15-23)24-16-10-5-11-17-24/h3-20H,1-2H3 |
| InChIKey | CGPRWXYKYMIONH-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.90 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|