C14H14Cl2O2Te — CID 162786996
2-[dichloro(phenyl)-λ4-tellanyl]-1,4-dimethoxybenzene (PubChem CID 162786996) has the molecular formula C14H14Cl2O2Te and a molecular weight of 412.77 g/mol. Its IUPAC name is 2-[dichloro(phenyl)-λ4-tellanyl]-1,4-dimethoxybenzene.
| Compound Name | 2-[dichloro(phenyl)-λ4-tellanyl]-1,4-dimethoxybenzene |
|---|---|
| PubChem CID | 162786996 |
| Molecular Formula | C14H14Cl2O2Te |
| Molecular Weight | 412.77 g/mol |
| Exact Mass | 413.94 |
| IUPAC Name | 2-[dichloro(phenyl)-λ4-tellanyl]-1,4-dimethoxybenzene |
| SMILES | COc1ccc(OC)c([Te](Cl)(Cl)c2ccccc2)c1 |
| InChI | InChI=1S/C14H14Cl2O2Te/c1-17-11-8-9-13(18-2)14(10-11)19(15,16)12-6-4-3-5-7-12/h3-10H,1-2H3 |
| InChIKey | CPPXCLUMJHGBOI-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.77 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|