C16H19NO4 — CID 118733560
ethyl-(2-phenylprop-2-enyl)-prop-2-ynylazanium;2-hydroxy-2-oxoacetate (PubChem CID 118733560) has the molecular formula C16H19NO4 and a molecular weight of 289.33 g/mol. Its IUPAC name is ethyl-(2-phenylprop-2-enyl)-prop-2-ynylazanium;2-hydroxy-2-oxoacetate.
| Compound Name | ethyl-(2-phenylprop-2-enyl)-prop-2-ynylazanium;2-hydroxy-2-oxoacetate |
|---|---|
| PubChem CID | 118733560 |
| Molecular Formula | C16H19NO4 |
| Molecular Weight | 289.33 g/mol |
| Exact Mass | 289.13 |
| IUPAC Name | ethyl-(2-phenylprop-2-enyl)-prop-2-ynylazanium;2-hydroxy-2-oxoacetate |
| SMILES | C#CC[NH+](CC)CC(=C)c1ccccc1.O=C([O-])C(=O)O |
| InChI | InChI=1S/C14H17N.C2H2O4/c1-4-11-15(5-2)12-13(3)14-9-7-6-8-10-14;3-1(4)2(5)6/h1,6-10H,3,5,11-12H2,2H3;(H,3,4)(H,5,6) |
| InChIKey | UGUZZNYWXKQWDF-UHFFFAOYSA-N |
| XLogP | -0.94 |
| TPSA | 81.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.33 |
| LogP ≤ 5 | -0.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|