C33H47NO3 — CID 118734728
(2R,4aS,6aR,6aS,14aS,14bR)-N-butyl-10-hydroxy-2,4a,6a,6a,9,14a-hexamethyl-11-oxo-1,3,4,5,6,13,14,14b-octahydropicene-2-carboxamide (PubChem CID 118734728) has the molecular formula C33H47NO3 and a molecular weight of 505.74 g/mol. Its IUPAC name is (2R,4aS,6aR,6aS,14aS,14bR)-N-butyl-10-hydroxy-2,4a,6a,6a,9,14a-hexamethyl-11-oxo-1,3,4,5,6,13,14,14b-octahydropicene-2-carboxamide.
| Compound Name | (2R,4aS,6aR,6aS,14aS,14bR)-N-butyl-10-hydroxy-2,4a,6a,6a,9,14a-hexamethyl-11-oxo-1,3,4,5,6,13,14,14b-octahydropicene-2-carboxamide |
|---|---|
| PubChem CID | 118734728 |
| Molecular Formula | C33H47NO3 |
| Molecular Weight | 505.74 g/mol |
| Exact Mass | 505.36 |
| IUPAC Name | (2R,4aS,6aR,6aS,14aS,14bR)-N-butyl-10-hydroxy-2,4a,6a,6a,9,14a-hexamethyl-11-oxo-1,3,4,5,6,13,14,14b-octahydropicene-2-carboxamide |
| SMILES | CCCCNC(=O)[C@]1(C)CC[C@]2(C)CC[C@]3(C)C4=CC=C5C(=CC(=O)C(O)=C5C)[C@]4(C)CC[C@@]3(C)[C@@H]2C1 |
| InChI | InChI=1S/C33H47NO3/c1-8-9-18-34-28(37)30(4)13-12-29(3)14-16-32(6)25-11-10-22-21(2)27(36)24(35)19-23(22)31(25,5)15-17-33(32,7)26(29)20-30/h10-11,19,26,36H,8-9,12-18,20H2,1-7H3,(H,34,37)/t26-,29-,30-,31+,32-,33+/m1/s1 |
| InChIKey | FAPMCLDBUPZHLM-CDKFMWKUSA-N |
| XLogP | 7.53 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.74 |
| LogP ≤ 5 | 7.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|