C22H30N7O8P — CID 118735755
ethyl (2S)-2-[[[(2R,3R,4R,5R)-5-(2,6-diaminopurin-9-yl)-3,4-dihydroxy-4-methyloxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate (PubChem CID 118735755) has the molecular formula C22H30N7O8P and a molecular weight of 551.50 g/mol. Its IUPAC name is ethyl (2S)-2-[[[(2R,3R,4R,5R)-5-(2,6-diaminopurin-9-yl)-3,4-dihydroxy-4-methyloxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate.
| Compound Name | ethyl (2S)-2-[[[(2R,3R,4R,5R)-5-(2,6-diaminopurin-9-yl)-3,4-dihydroxy-4-methyloxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate |
|---|---|
| PubChem CID | 118735755 |
| Molecular Formula | C22H30N7O8P |
| Molecular Weight | 551.50 g/mol |
| Exact Mass | 551.19 |
| IUPAC Name | ethyl (2S)-2-[[[(2R,3R,4R,5R)-5-(2,6-diaminopurin-9-yl)-3,4-dihydroxy-4-methyloxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate |
| SMILES | CCOC(=O)[C@H](C)NP(=O)(OC[C@H]1O[C@@H](n2cnc3c(N)nc(N)nc32)[C@](C)(O)[C@@H]1O)Oc1ccccc1 |
| InChI | InChI=1S/C22H30N7O8P/c1-4-34-19(31)12(2)28-38(33,37-13-8-6-5-7-9-13)35-10-14-16(30)22(3,32)20(36-14)29-11-25-15-17(23)26-21(24)27-18(15)29/h5-9,11-12,14,16,20,30,32H,4,10H2,1-3H3,(H,28,33)(H4,23,24,26,27)/t12-,14+,16+,20+,22+,38?/m0/s1 |
| InChIKey | KRZCISOPODLRMT-ONZINJAMSA-N |
| XLogP | 0.74 |
| TPSA | 219.19 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.50 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|