C19H12BrN5O2S — CID 118737093
4-[3-(2-aminopyrimidin-4-yl)-5-bromoindol-1-yl]sulfonylbenzonitrile (PubChem CID 118737093) has the molecular formula C19H12BrN5O2S and a molecular weight of 454.31 g/mol. Its IUPAC name is 4-[3-(2-aminopyrimidin-4-yl)-5-bromoindol-1-yl]sulfonylbenzonitrile.
| Compound Name | 4-[3-(2-aminopyrimidin-4-yl)-5-bromoindol-1-yl]sulfonylbenzonitrile |
|---|---|
| PubChem CID | 118737093 |
| Molecular Formula | C19H12BrN5O2S |
| Molecular Weight | 454.31 g/mol |
| Exact Mass | 452.99 |
| IUPAC Name | 4-[3-(2-aminopyrimidin-4-yl)-5-bromoindol-1-yl]sulfonylbenzonitrile |
| SMILES | N#Cc1ccc(S(=O)(=O)n2cc(-c3ccnc(N)n3)c3cc(Br)ccc32)cc1 |
| InChI | InChI=1S/C19H12BrN5O2S/c20-13-3-6-18-15(9-13)16(17-7-8-23-19(22)24-17)11-25(18)28(26,27)14-4-1-12(10-21)2-5-14/h1-9,11H,(H2,22,23,24) |
| InChIKey | KDJUDNGWIGHGDS-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 114.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.31 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |