C21H20ClNO3S — CID 118737152
3-[3-(4-chloro-3-methylphenoxy)propyl]-9-thia-1-azatricyclo[6.3.1.04,12]dodeca-2,4(12),5,7-tetraene-2-carboxylic acid (PubChem CID 118737152) has the molecular formula C21H20ClNO3S and a molecular weight of 401.92 g/mol. Its IUPAC name is 3-[3-(4-chloro-3-methylphenoxy)propyl]-9-thia-1-azatricyclo[6.3.1.04,12]dodeca-2,4(12),5,7-tetraene-2-carboxylic acid.
| Compound Name | 3-[3-(4-chloro-3-methylphenoxy)propyl]-9-thia-1-azatricyclo[6.3.1.04,12]dodeca-2,4(12),5,7-tetraene-2-carboxylic acid |
|---|---|
| PubChem CID | 118737152 |
| Molecular Formula | C21H20ClNO3S |
| Molecular Weight | 401.92 g/mol |
| Exact Mass | 401.09 |
| IUPAC Name | 3-[3-(4-chloro-3-methylphenoxy)propyl]-9-thia-1-azatricyclo[6.3.1.04,12]dodeca-2,4(12),5,7-tetraene-2-carboxylic acid |
| SMILES | Cc1cc(OCCCc2c(C(=O)O)n3c4c(cccc24)SCC3)ccc1Cl |
| InChI | InChI=1S/C21H20ClNO3S/c1-13-12-14(7-8-17(13)22)26-10-3-5-16-15-4-2-6-18-19(15)23(9-11-27-18)20(16)21(24)25/h2,4,6-8,12H,3,5,9-11H2,1H3,(H,24,25) |
| InChIKey | XWIOEODLFVLVCY-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 51.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.92 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|