C22H22ClNO3S — CID 118737153
3-[3-(4-chloro-3,5-dimethylphenoxy)propyl]-9-thia-1-azatricyclo[6.3.1.04,12]dodeca-2,4(12),5,7-tetraene-2-carboxylic acid (PubChem CID 118737153) has the molecular formula C22H22ClNO3S and a molecular weight of 415.94 g/mol. Its IUPAC name is 3-[3-(4-chloro-3,5-dimethylphenoxy)propyl]-9-thia-1-azatricyclo[6.3.1.04,12]dodeca-2,4(12),5,7-tetraene-2-carboxylic acid.
| Compound Name | 3-[3-(4-chloro-3,5-dimethylphenoxy)propyl]-9-thia-1-azatricyclo[6.3.1.04,12]dodeca-2,4(12),5,7-tetraene-2-carboxylic acid |
|---|---|
| PubChem CID | 118737153 |
| Molecular Formula | C22H22ClNO3S |
| Molecular Weight | 415.94 g/mol |
| Exact Mass | 415.10 |
| IUPAC Name | 3-[3-(4-chloro-3,5-dimethylphenoxy)propyl]-9-thia-1-azatricyclo[6.3.1.04,12]dodeca-2,4(12),5,7-tetraene-2-carboxylic acid |
| SMILES | Cc1cc(OCCCc2c(C(=O)O)n3c4c(cccc24)SCC3)cc(C)c1Cl |
| InChI | InChI=1S/C22H22ClNO3S/c1-13-11-15(12-14(2)19(13)23)27-9-4-6-17-16-5-3-7-18-20(16)24(8-10-28-18)21(17)22(25)26/h3,5,7,11-12H,4,6,8-10H2,1-2H3,(H,25,26) |
| InChIKey | NZEFYOHVASXLPS-UHFFFAOYSA-N |
| XLogP | 5.73 |
| TPSA | 51.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.94 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|