C30H36N2O7 — CID 118737840
[(Z)-4-[(1S,2S,13S,15R)-8-hydroxy-17,17-dimethyl-10,14-dioxo-3,16-dioxapentacyclo[11.4.1.02,11.02,15.04,9]octadeca-4,6,8,11-tetraen-15-yl]-2-methylbut-2-enyl] 2-(4-methylpiperazin-1-yl)acetate (PubChem CID 118737840) has the molecular formula C30H36N2O7 and a molecular weight of 536.63 g/mol. Its IUPAC name is [(Z)-4-[(1S,2S,13S,15R)-8-hydroxy-17,17-dimethyl-10,14-dioxo-3,16-dioxapentacyclo[11.4.1.02,11.02,15.04,9]octadeca-4,6,8,11-tetraen-15-yl]-2-methylbut-2-enyl] 2-(4-methylpiperazin-1-yl)acetate.
| Compound Name | [(Z)-4-[(1S,2S,13S,15R)-8-hydroxy-17,17-dimethyl-10,14-dioxo-3,16-dioxapentacyclo[11.4.1.02,11.02,15.04,9]octadeca-4,6,8,11-tetraen-15-yl]-2-methylbut-2-enyl] 2-(4-methylpiperazin-1-yl)acetate |
|---|---|
| PubChem CID | 118737840 |
| Molecular Formula | C30H36N2O7 |
| Molecular Weight | 536.63 g/mol |
| Exact Mass | 536.25 |
| IUPAC Name | [(Z)-4-[(1S,2S,13S,15R)-8-hydroxy-17,17-dimethyl-10,14-dioxo-3,16-dioxapentacyclo[11.4.1.02,11.02,15.04,9]octadeca-4,6,8,11-tetraen-15-yl]-2-methylbut-2-enyl] 2-(4-methylpiperazin-1-yl)acetate |
| SMILES | C/C(=C/C[C@@]12OC(C)(C)[C@@H]3C[C@@H](C=C4C(=O)c5c(O)cccc5O[C@]431)C2=O)COC(=O)CN1CCN(C)CC1 |
| InChI | InChI=1S/C30H36N2O7/c1-18(17-37-24(34)16-32-12-10-31(4)11-13-32)8-9-29-27(36)19-14-20-26(35)25-21(33)6-5-7-22(25)38-30(20,29)23(15-19)28(2,3)39-29/h5-8,14,19,23,33H,9-13,15-17H2,1-4H3/b18-8-/t19-,23+,29+,30-/m1/s1 |
| InChIKey | OTVQYXUVTSSKBE-FJKPPXSBSA-N |
| XLogP | 2.53 |
| TPSA | 105.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.63 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|