C21H20O6 — CID 132601722
8-hydroxy-15-[(E)-4-hydroxy-3-methylbut-2-enyl]-3,16-dioxapentacyclo[11.4.1.02,11.02,15.04,9]octadeca-4,6,8,11-tetraene-10,14-dione (PubChem CID 132601722) has the molecular formula C21H20O6 and a molecular weight of 368.39 g/mol. Its IUPAC name is 8-hydroxy-15-[(E)-4-hydroxy-3-methylbut-2-enyl]-3,16-dioxapentacyclo[11.4.1.02,11.02,15.04,9]octadeca-4,6,8,11-tetraene-10,14-dione.
| Compound Name | 8-hydroxy-15-[(E)-4-hydroxy-3-methylbut-2-enyl]-3,16-dioxapentacyclo[11.4.1.02,11.02,15.04,9]octadeca-4,6,8,11-tetraene-10,14-dione |
|---|---|
| PubChem CID | 132601722 |
| Molecular Formula | C21H20O6 |
| Molecular Weight | 368.39 g/mol |
| Exact Mass | 368.13 |
| IUPAC Name | 8-hydroxy-15-[(E)-4-hydroxy-3-methylbut-2-enyl]-3,16-dioxapentacyclo[11.4.1.02,11.02,15.04,9]octadeca-4,6,8,11-tetraene-10,14-dione |
| SMILES | C/C(=C\CC12OCC3CC(C=C4C(=O)c5c(O)cccc5OC431)C2=O)CO |
| InChI | InChI=1S/C21H20O6/c1-11(9-22)5-6-20-19(25)12-7-13(10-26-20)21(20)14(8-12)18(24)17-15(23)3-2-4-16(17)27-21/h2-5,8,12-13,22-23H,6-7,9-10H2,1H3/b11-5+ |
| InChIKey | NOBZERYHWVJZAV-VZUCSPMQSA-N |
| XLogP | 1.95 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.39 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|