C18H26N2O4 — CID 118738659
2-methoxyethyl (7S,8R,8aS)-7-(hydroxymethyl)-8-phenyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazine-2-carboxylate (PubChem CID 118738659) has the molecular formula C18H26N2O4 and a molecular weight of 334.42 g/mol. Its IUPAC name is 2-methoxyethyl (7S,8R,8aS)-7-(hydroxymethyl)-8-phenyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazine-2-carboxylate.
| Compound Name | 2-methoxyethyl (7S,8R,8aS)-7-(hydroxymethyl)-8-phenyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazine-2-carboxylate |
|---|---|
| PubChem CID | 118738659 |
| Molecular Formula | C18H26N2O4 |
| Molecular Weight | 334.42 g/mol |
| Exact Mass | 334.19 |
| IUPAC Name | 2-methoxyethyl (7S,8R,8aS)-7-(hydroxymethyl)-8-phenyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazine-2-carboxylate |
| SMILES | COCCOC(=O)N1CCN2C[C@@H](CO)[C@H](c3ccccc3)[C@H]2C1 |
| InChI | InChI=1S/C18H26N2O4/c1-23-9-10-24-18(22)20-8-7-19-11-15(13-21)17(16(19)12-20)14-5-3-2-4-6-14/h2-6,15-17,21H,7-13H2,1H3/t15-,16+,17-/m0/s1 |
| InChIKey | LISXXAOVERCDKK-BBWFWOEESA-N |
| XLogP | 1.16 |
| TPSA | 62.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.42 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|