C16H22N2O2 — CID 118738669
1-[(7R,8S,8aS)-7-(hydroxymethyl)-8-phenyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl]ethanone (PubChem CID 118738669) has the molecular formula C16H22N2O2 and a molecular weight of 274.36 g/mol. Its IUPAC name is 1-[(7R,8S,8aS)-7-(hydroxymethyl)-8-phenyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl]ethanone.
| Compound Name | 1-[(7R,8S,8aS)-7-(hydroxymethyl)-8-phenyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl]ethanone |
|---|---|
| PubChem CID | 118738669 |
| Molecular Formula | C16H22N2O2 |
| Molecular Weight | 274.36 g/mol |
| Exact Mass | 274.17 |
| IUPAC Name | 1-[(7R,8S,8aS)-7-(hydroxymethyl)-8-phenyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl]ethanone |
| SMILES | CC(=O)N1CCN2C[C@H](CO)[C@@H](c3ccccc3)[C@H]2C1 |
| InChI | InChI=1S/C16H22N2O2/c1-12(20)17-7-8-18-9-14(11-19)16(15(18)10-17)13-5-3-2-4-6-13/h2-6,14-16,19H,7-11H2,1H3/t14-,15-,16-/m1/s1 |
| InChIKey | OZOCBUSTAXCDAE-BZUAXINKSA-N |
| XLogP | 0.93 |
| TPSA | 43.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.36 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |