C20H30N2O3 — CID 118738816
ethyl 2-[9-(2-phenoxyethyl)-2,9-diazaspiro[4.5]decan-2-yl]acetate (PubChem CID 118738816) has the molecular formula C20H30N2O3 and a molecular weight of 346.47 g/mol. Its IUPAC name is ethyl 2-[9-(2-phenoxyethyl)-2,9-diazaspiro[4.5]decan-2-yl]acetate.
| Compound Name | ethyl 2-[9-(2-phenoxyethyl)-2,9-diazaspiro[4.5]decan-2-yl]acetate |
|---|---|
| PubChem CID | 118738816 |
| Molecular Formula | C20H30N2O3 |
| Molecular Weight | 346.47 g/mol |
| Exact Mass | 346.23 |
| IUPAC Name | ethyl 2-[9-(2-phenoxyethyl)-2,9-diazaspiro[4.5]decan-2-yl]acetate |
| SMILES | CCOC(=O)CN1CCC2(CCCN(CCOc3ccccc3)C2)C1 |
| InChI | InChI=1S/C20H30N2O3/c1-2-24-19(23)15-22-12-10-20(17-22)9-6-11-21(16-20)13-14-25-18-7-4-3-5-8-18/h3-5,7-8H,2,6,9-17H2,1H3 |
| InChIKey | YNADHSARQSWVJR-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 42.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.47 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |