About N-cyclopentylspiro[1,2-dihydroindene-3,4'-piperidine]-1-amine;dihydrochloride
N-cyclopentylspiro[1,2-dihydroindene-3,4'-piperidine]-1-amine;dihydrochloride (PubChem CID 118742131) has the molecular formula C18H28Cl2N2
and a molecular weight of 343.34 g/mol. Its IUPAC name is N-cyclopentylspiro[1,2-dihydroindene-3,4'-piperidine]-1-amine;dihydrochloride.
Molecular Properties
| Compound Name | N-cyclopentylspiro[1,2-dihydroindene-3,4'-piperidine]-1-amine;dihydrochloride |
| PubChem CID | 118742131 |
| Molecular Formula | C18H28Cl2N2 |
| Molecular Weight | 343.34 g/mol |
| Exact Mass | 342.16 |
| IUPAC Name | N-cyclopentylspiro[1,2-dihydroindene-3,4'-piperidine]-1-amine;dihydrochloride |
| SMILES | Cl.Cl.c1ccc2c(c1)C(NC1CCCC1)CC21CCNCC1 |
| InChI | InChI=1S/C18H26N2.2ClH/c1-2-6-14(5-1)20-17-13-18(9-11-19-12-10-18)16-8-4-3-7-15(16)17;;/h3-4,7-8,14,17,19-20H,1-2,5-6,9-13H2;2*1H |
| InChIKey | LWAKKXCLEAHKRI-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 343.34 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N-cyclopentylspiro[1,2-dihydroindene-3,4'-piperidine]-1-amine;dihydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-cyclopentylspiro[1,2-dihydroindene-3,4'-piperidine]-1-amine;dihydrochloride?
The IUPAC name of N-cyclopentylspiro[1,2-dihydroindene-3,4'-piperidine]-1-amine;dihydrochloride (CID 118742131) is N-cyclopentylspiro[1,2-dihydroindene-3,4'-piperidine]-1-amine;dihydrochloride.
What is the SMILES notation for N-cyclopentylspiro[1,2-dihydroindene-3,4'-piperidine]-1-amine;dihydrochloride?
The canonical SMILES for N-cyclopentylspiro[1,2-dihydroindene-3,4'-piperidine]-1-amine;dihydrochloride is Cl.Cl.c1ccc2c(c1)C(NC1CCCC1)CC21CCNCC1.
What is the InChIKey of N-cyclopentylspiro[1,2-dihydroindene-3,4'-piperidine]-1-amine;dihydrochloride?
The InChIKey is LWAKKXCLEAHKRI-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H26N2.2ClH/c1-2-6-14(5-1)20-17-13-18(9-11-19-12-10-18)16-8-4-3-7-15(16)17;;/h3-4,7-8,14,17,19-20H,1-2,5-6,9-13H2;2*1H.
What are the key properties of N-cyclopentylspiro[1,2-dihydroindene-3,4'-piperidine]-1-amine;dihydrochloride?
N-cyclopentylspiro[1,2-dihydroindene-3,4'-piperidine]-1-amine;dihydrochloride has a molecular weight of 343.34 g/mol, XLogP of 4.13, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-cyclopentylspiro[1,2-dihydroindene-3,4'-piperidine]-1-amine;dihydrochloride is sourced from PubChem (CID 118742131), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).