C20H28F3N5O3 — CID 118744647
N-cyclobutyl-2-[1-(2-methoxyethyl)piperidin-4-yl]-[1,2,4]triazolo[1,5-a]pyridin-6-amine;2,2,2-trifluoroacetic acid (PubChem CID 118744647) has the molecular formula C20H28F3N5O3 and a molecular weight of 443.47 g/mol. Its IUPAC name is N-cyclobutyl-2-[1-(2-methoxyethyl)piperidin-4-yl]-[1,2,4]triazolo[1,5-a]pyridin-6-amine;2,2,2-trifluoroacetic acid.
| Compound Name | N-cyclobutyl-2-[1-(2-methoxyethyl)piperidin-4-yl]-[1,2,4]triazolo[1,5-a]pyridin-6-amine;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 118744647 |
| Molecular Formula | C20H28F3N5O3 |
| Molecular Weight | 443.47 g/mol |
| Exact Mass | 443.21 |
| IUPAC Name | N-cyclobutyl-2-[1-(2-methoxyethyl)piperidin-4-yl]-[1,2,4]triazolo[1,5-a]pyridin-6-amine;2,2,2-trifluoroacetic acid |
| SMILES | COCCN1CCC(c2nc3ccc(NC4CCC4)cn3n2)CC1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C18H27N5O.C2HF3O2/c1-24-12-11-22-9-7-14(8-10-22)18-20-17-6-5-16(13-23(17)21-18)19-15-3-2-4-15;3-2(4,5)1(6)7/h5-6,13-15,19H,2-4,7-12H2,1H3;(H,6,7) |
| InChIKey | ASJNWKZPPIYQAL-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 91.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.47 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |