C27H27F6N5O5 — CID 155847875
2-[1-[(5-methylfuran-2-yl)methyl]piperidin-4-yl]-N-phenyl-[1,2,4]triazolo[1,5-a]pyridin-6-amine;bis(2,2,2-trifluoroacetic acid) (PubChem CID 155847875) has the molecular formula C27H27F6N5O5 and a molecular weight of 615.53 g/mol. Its IUPAC name is 2-[1-[(5-methylfuran-2-yl)methyl]piperidin-4-yl]-N-phenyl-[1,2,4]triazolo[1,5-a]pyridin-6-amine;bis(2,2,2-trifluoroacetic acid).
| Compound Name | 2-[1-[(5-methylfuran-2-yl)methyl]piperidin-4-yl]-N-phenyl-[1,2,4]triazolo[1,5-a]pyridin-6-amine;bis(2,2,2-trifluoroacetic acid) |
|---|---|
| PubChem CID | 155847875 |
| Molecular Formula | C27H27F6N5O5 |
| Molecular Weight | 615.53 g/mol |
| Exact Mass | 615.19 |
| IUPAC Name | 2-[1-[(5-methylfuran-2-yl)methyl]piperidin-4-yl]-N-phenyl-[1,2,4]triazolo[1,5-a]pyridin-6-amine;bis(2,2,2-trifluoroacetic acid) |
| SMILES | Cc1ccc(CN2CCC(c3nc4ccc(Nc5ccccc5)cn4n3)CC2)o1.O=C(O)C(F)(F)F.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C23H25N5O.2C2HF3O2/c1-17-7-9-21(29-17)16-27-13-11-18(12-14-27)23-25-22-10-8-20(15-28(22)26-23)24-19-5-3-2-4-6-19;2*3-2(4,5)1(6)7/h2-10,15,18,24H,11-14,16H2,1H3;2*(H,6,7) |
| InChIKey | LYNIYHQBWQSGRR-UHFFFAOYSA-N |
| XLogP | 6.02 |
| TPSA | 133.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 615.53 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |