C18H22F6N4O6S — CID 118745894
1-[2-(2-methoxyethyl)-5,7-dihydro-4H-pyrano[3,4-c]pyrazol-7-yl]-N-(1,3-thiazol-2-ylmethyl)methanamine;bis(2,2,2-trifluoroacetic acid) (PubChem CID 118745894) has the molecular formula C18H22F6N4O6S and a molecular weight of 536.45 g/mol. Its IUPAC name is 1-[2-(2-methoxyethyl)-5,7-dihydro-4H-pyrano[3,4-c]pyrazol-7-yl]-N-(1,3-thiazol-2-ylmethyl)methanamine;bis(2,2,2-trifluoroacetic acid).
| Compound Name | 1-[2-(2-methoxyethyl)-5,7-dihydro-4H-pyrano[3,4-c]pyrazol-7-yl]-N-(1,3-thiazol-2-ylmethyl)methanamine;bis(2,2,2-trifluoroacetic acid) |
|---|---|
| PubChem CID | 118745894 |
| Molecular Formula | C18H22F6N4O6S |
| Molecular Weight | 536.45 g/mol |
| Exact Mass | 536.12 |
| IUPAC Name | 1-[2-(2-methoxyethyl)-5,7-dihydro-4H-pyrano[3,4-c]pyrazol-7-yl]-N-(1,3-thiazol-2-ylmethyl)methanamine;bis(2,2,2-trifluoroacetic acid) |
| SMILES | COCCn1cc2c(n1)C(CNCc1nccs1)OCC2.O=C(O)C(F)(F)F.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C14H20N4O2S.2C2HF3O2/c1-19-6-4-18-10-11-2-5-20-12(14(11)17-18)8-15-9-13-16-3-7-21-13;2*3-2(4,5)1(6)7/h3,7,10,12,15H,2,4-6,8-9H2,1H3;2*(H,6,7) |
| InChIKey | GHKSXWJWDFKSRJ-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 135.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.45 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |