C26H34N2O2 — CID 11876007
(3S,8S,9R,10R,13R,14S)-17-[3-(furan-2-yl)prop-2-enylidenehydrazinylidene]-10,13-dimethyl-1,2,3,4,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthren-3-ol (PubChem CID 11876007) has the molecular formula C26H34N2O2 and a molecular weight of 406.57 g/mol. Its IUPAC name is (3S,8S,9R,10R,13R,14S)-17-[3-(furan-2-yl)prop-2-enylidenehydrazinylidene]-10,13-dimethyl-1,2,3,4,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthren-3-ol.
| Compound Name | (3S,8S,9R,10R,13R,14S)-17-[3-(furan-2-yl)prop-2-enylidenehydrazinylidene]-10,13-dimethyl-1,2,3,4,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthren-3-ol |
|---|---|
| PubChem CID | 11876007 |
| Molecular Formula | C26H34N2O2 |
| Molecular Weight | 406.57 g/mol |
| Exact Mass | 406.26 |
| IUPAC Name | (3S,8S,9R,10R,13R,14S)-17-[3-(furan-2-yl)prop-2-enylidenehydrazinylidene]-10,13-dimethyl-1,2,3,4,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthren-3-ol |
| SMILES | C[C@]12CC[C@H](O)CC1=CC[C@H]1[C@H]2CC[C@@]2(C)C(=NN=CC=Cc3ccco3)CC[C@@H]12 |
| InChI | InChI=1S/C26H34N2O2/c1-25-13-11-19(29)17-18(25)7-8-21-22-9-10-24(26(22,2)14-12-23(21)25)28-27-15-3-5-20-6-4-16-30-20/h3-7,15-16,19,21-23,29H,8-14,17H2,1-2H3/t19-,21+,22-,23+,25-,26+/m0/s1 |
| InChIKey | UMTNXSOYNXUORQ-QZEFQHSTSA-N |
| XLogP | 6.04 |
| TPSA | 58.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.57 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_imine_B(3)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|