C24H31N3O3S — CID 125027443
(3R,8S,9R,10R,13S,14S,17Z)-10,13-dimethyl-17-[(Z)-(5-nitrothiophen-2-yl)methylidenehydrazinylidene]-1,2,3,4,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthren-3-ol (PubChem CID 125027443) has the molecular formula C24H31N3O3S and a molecular weight of 441.60 g/mol. Its IUPAC name is (3R,8S,9R,10R,13S,14S,17Z)-10,13-dimethyl-17-[(Z)-(5-nitrothiophen-2-yl)methylidenehydrazinylidene]-1,2,3,4,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthren-3-ol.
| Compound Name | (3R,8S,9R,10R,13S,14S,17Z)-10,13-dimethyl-17-[(Z)-(5-nitrothiophen-2-yl)methylidenehydrazinylidene]-1,2,3,4,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthren-3-ol |
|---|---|
| PubChem CID | 125027443 |
| Molecular Formula | C24H31N3O3S |
| Molecular Weight | 441.60 g/mol |
| Exact Mass | 441.21 |
| IUPAC Name | (3R,8S,9R,10R,13S,14S,17Z)-10,13-dimethyl-17-[(Z)-(5-nitrothiophen-2-yl)methylidenehydrazinylidene]-1,2,3,4,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthren-3-ol |
| SMILES | C[C@]12CC[C@@H](O)CC1=CC[C@H]1[C@H]2CC[C@]2(C)/C(=N\N=C/c3ccc([N+](=O)[O-])s3)CC[C@@H]12 |
| InChI | InChI=1S/C24H31N3O3S/c1-23-11-9-16(28)13-15(23)3-5-18-19-6-7-21(24(19,2)12-10-20(18)23)26-25-14-17-4-8-22(31-17)27(29)30/h3-4,8,14,16,18-20,28H,5-7,9-13H2,1-2H3/b25-14-,26-21-/t16-,18-,19+,20-,23+,24+/m1/s1 |
| InChIKey | BKFIBDWKIPCPQA-FCKDWQCFSA-N |
| XLogP | 5.75 |
| TPSA | 88.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.60 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|