C25H33N3O — CID 177412988
(3S,8R,9S,10R,13S,14S,17E)-10,13-dimethyl-17-[(E)-pyridin-3-ylmethylidenehydrazinylidene]-1,2,3,4,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthren-3-ol (PubChem CID 177412988) has the molecular formula C25H33N3O and a molecular weight of 391.56 g/mol. Its IUPAC name is (3S,8R,9S,10R,13S,14S,17E)-10,13-dimethyl-17-[(E)-pyridin-3-ylmethylidenehydrazinylidene]-1,2,3,4,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthren-3-ol.
| Compound Name | (3S,8R,9S,10R,13S,14S,17E)-10,13-dimethyl-17-[(E)-pyridin-3-ylmethylidenehydrazinylidene]-1,2,3,4,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthren-3-ol |
|---|---|
| PubChem CID | 177412988 |
| Molecular Formula | C25H33N3O |
| Molecular Weight | 391.56 g/mol |
| Exact Mass | 391.26 |
| IUPAC Name | (3S,8R,9S,10R,13S,14S,17E)-10,13-dimethyl-17-[(E)-pyridin-3-ylmethylidenehydrazinylidene]-1,2,3,4,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthren-3-ol |
| SMILES | C[C@]12CC[C@H](O)CC1=CC[C@@H]1[C@@H]2CC[C@]2(C)/C(=N/N=C/c3cccnc3)CC[C@@H]12 |
| InChI | InChI=1S/C25H33N3O/c1-24-11-9-19(29)14-18(24)5-6-20-21-7-8-23(25(21,2)12-10-22(20)24)28-27-16-17-4-3-13-26-15-17/h3-5,13,15-16,19-22,29H,6-12,14H2,1-2H3/b27-16+,28-23+/t19-,20-,21-,22-,24-,25-/m0/s1 |
| InChIKey | BCLCTFGXCAWEOZ-LOIBYUIYSA-N |
| XLogP | 5.18 |
| TPSA | 57.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.56 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|