C27H33F3N2O — CID 124769197
(3S,8S,9R,10R,13S,14R,17Z)-10,13-dimethyl-17-[(Z)-[2-(trifluoromethyl)phenyl]methylidenehydrazinylidene]-1,2,3,4,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthren-3-ol (PubChem CID 124769197) has the molecular formula C27H33F3N2O and a molecular weight of 458.57 g/mol. Its IUPAC name is (3S,8S,9R,10R,13S,14R,17Z)-10,13-dimethyl-17-[(Z)-[2-(trifluoromethyl)phenyl]methylidenehydrazinylidene]-1,2,3,4,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthren-3-ol.
| Compound Name | (3S,8S,9R,10R,13S,14R,17Z)-10,13-dimethyl-17-[(Z)-[2-(trifluoromethyl)phenyl]methylidenehydrazinylidene]-1,2,3,4,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthren-3-ol |
|---|---|
| PubChem CID | 124769197 |
| Molecular Formula | C27H33F3N2O |
| Molecular Weight | 458.57 g/mol |
| Exact Mass | 458.25 |
| IUPAC Name | (3S,8S,9R,10R,13S,14R,17Z)-10,13-dimethyl-17-[(Z)-[2-(trifluoromethyl)phenyl]methylidenehydrazinylidene]-1,2,3,4,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthren-3-ol |
| SMILES | C[C@]12CC[C@H](O)CC1=CC[C@H]1[C@H]2CC[C@]2(C)/C(=N\N=C/c3ccccc3C(F)(F)F)CC[C@H]12 |
| InChI | InChI=1S/C27H33F3N2O/c1-25-13-11-19(33)15-18(25)7-8-20-22-9-10-24(26(22,2)14-12-23(20)25)32-31-16-17-5-3-4-6-21(17)27(28,29)30/h3-7,16,19-20,22-23,33H,8-15H2,1-2H3/b31-16-,32-24-/t19-,20+,22+,23+,25-,26-/m0/s1 |
| InChIKey | LNPBGIMDMAMUHR-KUIITCLTSA-N |
| XLogP | 6.80 |
| TPSA | 44.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.57 |
| LogP ≤ 5 | 6.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|