C27H35F3N2 — CID 51851948
(Z,5R,8S,9R,10S,13S,14R)-10,13-dimethyl-N-[(Z)-[2-(trifluoromethyl)phenyl]methylideneamino]-1,2,3,4,5,6,7,8,9,11,12,14,15,16-tetradecahydrocyclopenta[a]phenanthren-17-imine (PubChem CID 51851948) has the molecular formula C27H35F3N2 and a molecular weight of 444.59 g/mol. Its IUPAC name is (Z,5R,8S,9R,10S,13S,14R)-10,13-dimethyl-N-[(Z)-[2-(trifluoromethyl)phenyl]methylideneamino]-1,2,3,4,5,6,7,8,9,11,12,14,15,16-tetradecahydrocyclopenta[a]phenanthren-17-imine.
| Compound Name | (Z,5R,8S,9R,10S,13S,14R)-10,13-dimethyl-N-[(Z)-[2-(trifluoromethyl)phenyl]methylideneamino]-1,2,3,4,5,6,7,8,9,11,12,14,15,16-tetradecahydrocyclopenta[a]phenanthren-17-imine |
|---|---|
| PubChem CID | 51851948 |
| Molecular Formula | C27H35F3N2 |
| Molecular Weight | 444.59 g/mol |
| Exact Mass | 444.28 |
| IUPAC Name | (Z,5R,8S,9R,10S,13S,14R)-10,13-dimethyl-N-[(Z)-[2-(trifluoromethyl)phenyl]methylideneamino]-1,2,3,4,5,6,7,8,9,11,12,14,15,16-tetradecahydrocyclopenta[a]phenanthren-17-imine |
| SMILES | C[C@]12CCCC[C@@H]1CC[C@H]1[C@H]2CC[C@]2(C)/C(=N\N=C/c3ccccc3C(F)(F)F)CC[C@H]12 |
| InChI | InChI=1S/C27H35F3N2/c1-25-15-6-5-8-19(25)10-11-20-22-12-13-24(26(22,2)16-14-23(20)25)32-31-17-18-7-3-4-9-21(18)27(28,29)30/h3-4,7,9,17,19-20,22-23H,5-6,8,10-16H2,1-2H3/b31-17-,32-24-/t19-,20-,22-,23-,25+,26+/m1/s1 |
| InChIKey | FHIHDASURXFVSB-FTDABVJDSA-N |
| XLogP | 7.91 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.59 |
| LogP ≤ 5 | 7.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|