C25H38N4 — CID 124901171
(Z,5S,8S,9R,10S,13R,14R)-N-[(Z)-(1,3-dimethylpyrazol-4-yl)methylideneamino]-10,13-dimethyl-1,2,3,4,5,6,7,8,9,11,12,14,15,16-tetradecahydrocyclopenta[a]phenanthren-17-imine (PubChem CID 124901171) has the molecular formula C25H38N4 and a molecular weight of 394.61 g/mol. Its IUPAC name is (Z,5S,8S,9R,10S,13R,14R)-N-[(Z)-(1,3-dimethylpyrazol-4-yl)methylideneamino]-10,13-dimethyl-1,2,3,4,5,6,7,8,9,11,12,14,15,16-tetradecahydrocyclopenta[a]phenanthren-17-imine.
| Compound Name | (Z,5S,8S,9R,10S,13R,14R)-N-[(Z)-(1,3-dimethylpyrazol-4-yl)methylideneamino]-10,13-dimethyl-1,2,3,4,5,6,7,8,9,11,12,14,15,16-tetradecahydrocyclopenta[a]phenanthren-17-imine |
|---|---|
| PubChem CID | 124901171 |
| Molecular Formula | C25H38N4 |
| Molecular Weight | 394.61 g/mol |
| Exact Mass | 394.31 |
| IUPAC Name | (Z,5S,8S,9R,10S,13R,14R)-N-[(Z)-(1,3-dimethylpyrazol-4-yl)methylideneamino]-10,13-dimethyl-1,2,3,4,5,6,7,8,9,11,12,14,15,16-tetradecahydrocyclopenta[a]phenanthren-17-imine |
| SMILES | Cc1nn(C)cc1/C=N\N=C1/CC[C@@H]2[C@H]3CC[C@@H]4CCCC[C@]4(C)[C@@H]3CC[C@@]12C |
| InChI | InChI=1S/C25H38N4/c1-17-18(16-29(4)28-17)15-26-27-23-11-10-21-20-9-8-19-7-5-6-13-24(19,2)22(20)12-14-25(21,23)3/h15-16,19-22H,5-14H2,1-4H3/b26-15-,27-23+/t19-,20+,21+,22+,24-,25+/m0/s1 |
| InChIKey | XKGJSFZJELCKIZ-IPAFEXSMSA-N |
| XLogP | 5.94 |
| TPSA | 42.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.61 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|