C16H19N7O2S — CID 118762019
1-[3-(3-ethyl-1,2,4-oxadiazol-5-yl)phenyl]-3-[2-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]ethyl]urea (PubChem CID 118762019) has the molecular formula C16H19N7O2S and a molecular weight of 373.44 g/mol. Its IUPAC name is 1-[3-(3-ethyl-1,2,4-oxadiazol-5-yl)phenyl]-3-[2-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]ethyl]urea.
| Compound Name | 1-[3-(3-ethyl-1,2,4-oxadiazol-5-yl)phenyl]-3-[2-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]ethyl]urea |
|---|---|
| PubChem CID | 118762019 |
| Molecular Formula | C16H19N7O2S |
| Molecular Weight | 373.44 g/mol |
| Exact Mass | 373.13 |
| IUPAC Name | 1-[3-(3-ethyl-1,2,4-oxadiazol-5-yl)phenyl]-3-[2-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]ethyl]urea |
| SMILES | CCc1noc(-c2cccc(NC(=O)NCCSc3nncn3C)c2)n1 |
| InChI | InChI=1S/C16H19N7O2S/c1-3-13-20-14(25-22-13)11-5-4-6-12(9-11)19-15(24)17-7-8-26-16-21-18-10-23(16)2/h4-6,9-10H,3,7-8H2,1-2H3,(H2,17,19,24) |
| InChIKey | RYRHLYGKALEVPN-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 110.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.44 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|