C15H19N7OS — CID 118776868
1-(6,7-dimethyl-3H-benzimidazol-5-yl)-3-[2-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]ethyl]urea (PubChem CID 118776868) has the molecular formula C15H19N7OS and a molecular weight of 345.43 g/mol. Its IUPAC name is 1-(6,7-dimethyl-3H-benzimidazol-5-yl)-3-[2-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]ethyl]urea.
| Compound Name | 1-(6,7-dimethyl-3H-benzimidazol-5-yl)-3-[2-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]ethyl]urea |
|---|---|
| PubChem CID | 118776868 |
| Molecular Formula | C15H19N7OS |
| Molecular Weight | 345.43 g/mol |
| Exact Mass | 345.14 |
| IUPAC Name | 1-(6,7-dimethyl-3H-benzimidazol-5-yl)-3-[2-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]ethyl]urea |
| SMILES | Cc1c(NC(=O)NCCSc2nncn2C)cc2[nH]cnc2c1C |
| InChI | InChI=1S/C15H19N7OS/c1-9-10(2)13-12(17-7-18-13)6-11(9)20-14(23)16-4-5-24-15-21-19-8-22(15)3/h6-8H,4-5H2,1-3H3,(H,17,18)(H2,16,20,23) |
| InChIKey | NGWAVEMUCAJCLH-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 100.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.43 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|