C23H33N2O4+ — CID 11876285
2-O-[[(1S,9aS)-1,2,3,4,5,6,7,8,9,9a-decahydroquinolizin-5-ium-1-yl]methyl] 1-O-benzyl (2R)-pyrrolidine-1,2-dicarboxylate (PubChem CID 11876285) has the molecular formula C23H33N2O4+ and a molecular weight of 401.53 g/mol. Its IUPAC name is 2-O-[[(1S,9aS)-1,2,3,4,5,6,7,8,9,9a-decahydroquinolizin-5-ium-1-yl]methyl] 1-O-benzyl (2R)-pyrrolidine-1,2-dicarboxylate.
| Compound Name | 2-O-[[(1S,9aS)-1,2,3,4,5,6,7,8,9,9a-decahydroquinolizin-5-ium-1-yl]methyl] 1-O-benzyl (2R)-pyrrolidine-1,2-dicarboxylate |
|---|---|
| PubChem CID | 11876285 |
| Molecular Formula | C23H33N2O4+ |
| Molecular Weight | 401.53 g/mol |
| Exact Mass | 401.24 |
| IUPAC Name | 2-O-[[(1S,9aS)-1,2,3,4,5,6,7,8,9,9a-decahydroquinolizin-5-ium-1-yl]methyl] 1-O-benzyl (2R)-pyrrolidine-1,2-dicarboxylate |
| SMILES | O=C(OC[C@H]1CCC[NH+]2CCCC[C@@H]12)[C@H]1CCCN1C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C23H32N2O4/c26-22(28-17-19-10-6-14-24-13-5-4-11-20(19)24)21-12-7-15-25(21)23(27)29-16-18-8-2-1-3-9-18/h1-3,8-9,19-21H,4-7,10-17H2/p+1/t19-,20+,21-/m1/s1 |
| InChIKey | VLFJMSSAAUTMQU-QHAWAJNXSA-O |
| XLogP | 2.18 |
| TPSA | 60.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.53 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |