About 3-[benzyl(2,3-dihydro-1H-inden-4-ylcarbamoyl)amino]propanamide
3-[benzyl(2,3-dihydro-1H-inden-4-ylcarbamoyl)amino]propanamide (PubChem CID 118764444) has the molecular formula C20H23N3O2
and a molecular weight of 337.42 g/mol. Its IUPAC name is 3-[benzyl(2,3-dihydro-1H-inden-4-ylcarbamoyl)amino]propanamide.
Molecular Properties
| Compound Name | 3-[benzyl(2,3-dihydro-1H-inden-4-ylcarbamoyl)amino]propanamide |
| PubChem CID | 118764444 |
| Molecular Formula | C20H23N3O2 |
| Molecular Weight | 337.42 g/mol |
| Exact Mass | 337.18 |
| IUPAC Name | 3-[benzyl(2,3-dihydro-1H-inden-4-ylcarbamoyl)amino]propanamide |
| SMILES | NC(=O)CCN(Cc1ccccc1)C(=O)Nc1cccc2c1CCC2 |
| InChI | InChI=1S/C20H23N3O2/c21-19(24)12-13-23(14-15-6-2-1-3-7-15)20(25)22-18-11-5-9-16-8-4-10-17(16)18/h1-3,5-7,9,11H,4,8,10,12-14H2,(H2,21,24)(H,22,25) |
| InChIKey | VVJSZTFKNQYRHO-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 337.42 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-[benzyl(2,3-dihydro-1H-inden-4-ylcarbamoyl)amino]propanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[benzyl(2,3-dihydro-1H-inden-4-ylcarbamoyl)amino]propanamide?
The IUPAC name of 3-[benzyl(2,3-dihydro-1H-inden-4-ylcarbamoyl)amino]propanamide (CID 118764444) is 3-[benzyl(2,3-dihydro-1H-inden-4-ylcarbamoyl)amino]propanamide.
What is the SMILES notation for 3-[benzyl(2,3-dihydro-1H-inden-4-ylcarbamoyl)amino]propanamide?
The canonical SMILES for 3-[benzyl(2,3-dihydro-1H-inden-4-ylcarbamoyl)amino]propanamide is NC(=O)CCN(Cc1ccccc1)C(=O)Nc1cccc2c1CCC2.
What is the InChIKey of 3-[benzyl(2,3-dihydro-1H-inden-4-ylcarbamoyl)amino]propanamide?
The InChIKey is VVJSZTFKNQYRHO-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H23N3O2/c21-19(24)12-13-23(14-15-6-2-1-3-7-15)20(25)22-18-11-5-9-16-8-4-10-17(16)18/h1-3,5-7,9,11H,4,8,10,12-14H2,(H2,21,24)(H,22,25).
What are the key properties of 3-[benzyl(2,3-dihydro-1H-inden-4-ylcarbamoyl)amino]propanamide?
3-[benzyl(2,3-dihydro-1H-inden-4-ylcarbamoyl)amino]propanamide has a molecular weight of 337.42 g/mol, XLogP of 3.08, 6 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[benzyl(2,3-dihydro-1H-inden-4-ylcarbamoyl)amino]propanamide is sourced from PubChem (CID 118764444), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).