C20H23N5O — CID 118772820
3-(5-propan-2-yl-1H-1,2,4-triazol-3-yl)-N-(3-pyridin-2-ylpropyl)benzamide (PubChem CID 118772820) has the molecular formula C20H23N5O and a molecular weight of 349.44 g/mol. Its IUPAC name is 3-(5-propan-2-yl-1H-1,2,4-triazol-3-yl)-N-(3-pyridin-2-ylpropyl)benzamide.
| Compound Name | 3-(5-propan-2-yl-1H-1,2,4-triazol-3-yl)-N-(3-pyridin-2-ylpropyl)benzamide |
|---|---|
| PubChem CID | 118772820 |
| Molecular Formula | C20H23N5O |
| Molecular Weight | 349.44 g/mol |
| Exact Mass | 349.19 |
| IUPAC Name | 3-(5-propan-2-yl-1H-1,2,4-triazol-3-yl)-N-(3-pyridin-2-ylpropyl)benzamide |
| SMILES | CC(C)c1nc(-c2cccc(C(=O)NCCCc3ccccn3)c2)n[nH]1 |
| InChI | InChI=1S/C20H23N5O/c1-14(2)18-23-19(25-24-18)15-7-5-8-16(13-15)20(26)22-12-6-10-17-9-3-4-11-21-17/h3-5,7-9,11,13-14H,6,10,12H2,1-2H3,(H,22,26)(H,23,24,25) |
| InChIKey | DLYCURBYGXSLQB-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 83.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.44 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|