C14H22FN3O2 — CID 118773614
1-[2-(dimethylamino)ethyl]-1-ethyl-3-(2-fluoro-4-methoxyphenyl)urea (PubChem CID 118773614) has the molecular formula C14H22FN3O2 and a molecular weight of 283.35 g/mol. Its IUPAC name is 1-[2-(dimethylamino)ethyl]-1-ethyl-3-(2-fluoro-4-methoxyphenyl)urea.
| Compound Name | 1-[2-(dimethylamino)ethyl]-1-ethyl-3-(2-fluoro-4-methoxyphenyl)urea |
|---|---|
| PubChem CID | 118773614 |
| Molecular Formula | C14H22FN3O2 |
| Molecular Weight | 283.35 g/mol |
| Exact Mass | 283.17 |
| IUPAC Name | 1-[2-(dimethylamino)ethyl]-1-ethyl-3-(2-fluoro-4-methoxyphenyl)urea |
| SMILES | CCN(CCN(C)C)C(=O)Nc1ccc(OC)cc1F |
| InChI | InChI=1S/C14H22FN3O2/c1-5-18(9-8-17(2)3)14(19)16-13-7-6-11(20-4)10-12(13)15/h6-7,10H,5,8-9H2,1-4H3,(H,16,19) |
| InChIKey | YDHUKPONKQFVAV-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.35 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |