C14H22N4O3S — CID 118778630
N-[3-(4-hydroxypiperidin-1-yl)propyl]-2-methylsulfanyl-6-oxo-1H-pyrimidine-5-carboxamide (PubChem CID 118778630) has the molecular formula C14H22N4O3S and a molecular weight of 326.42 g/mol. Its IUPAC name is N-[3-(4-hydroxypiperidin-1-yl)propyl]-2-methylsulfanyl-6-oxo-1H-pyrimidine-5-carboxamide.
| Compound Name | N-[3-(4-hydroxypiperidin-1-yl)propyl]-2-methylsulfanyl-6-oxo-1H-pyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 118778630 |
| Molecular Formula | C14H22N4O3S |
| Molecular Weight | 326.42 g/mol |
| Exact Mass | 326.14 |
| IUPAC Name | N-[3-(4-hydroxypiperidin-1-yl)propyl]-2-methylsulfanyl-6-oxo-1H-pyrimidine-5-carboxamide |
| SMILES | CSc1ncc(C(=O)NCCCN2CCC(O)CC2)c(=O)[nH]1 |
| InChI | InChI=1S/C14H22N4O3S/c1-22-14-16-9-11(13(21)17-14)12(20)15-5-2-6-18-7-3-10(19)4-8-18/h9-10,19H,2-8H2,1H3,(H,15,20)(H,16,17,21) |
| InChIKey | WOTDMBGIMZEBAM-UHFFFAOYSA-N |
| XLogP | 0.07 |
| TPSA | 98.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.42 |
| LogP ≤ 5 | 0.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|