C14H22N2O2S2 — CID 111429524
N-[3-(4-hydroxypiperidin-1-yl)propyl]-3-methylsulfanylthiophene-2-carboxamide (PubChem CID 111429524) has the molecular formula C14H22N2O2S2 and a molecular weight of 314.48 g/mol. Its IUPAC name is N-[3-(4-hydroxypiperidin-1-yl)propyl]-3-methylsulfanylthiophene-2-carboxamide.
| Compound Name | N-[3-(4-hydroxypiperidin-1-yl)propyl]-3-methylsulfanylthiophene-2-carboxamide |
|---|---|
| PubChem CID | 111429524 |
| Molecular Formula | C14H22N2O2S2 |
| Molecular Weight | 314.48 g/mol |
| Exact Mass | 314.11 |
| IUPAC Name | N-[3-(4-hydroxypiperidin-1-yl)propyl]-3-methylsulfanylthiophene-2-carboxamide |
| SMILES | CSc1ccsc1C(=O)NCCCN1CCC(O)CC1 |
| InChI | InChI=1S/C14H22N2O2S2/c1-19-12-5-10-20-13(12)14(18)15-6-2-7-16-8-3-11(17)4-9-16/h5,10-11,17H,2-4,6-9H2,1H3,(H,15,18) |
| InChIKey | YLCJQQUXRGJOMT-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.48 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|